EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N3O13P3 |
| Net Charge | -4 |
| Average Mass | 463.125 |
| Monoisotopic Mass | 462.96049 |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O2)c(=O)n1 |
| InChI | InChI=1S/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/p-4/t5-,6+,8+/m0/s1 |
| InChIKey | RGWHQCVHVJXOKC-SHYZEUOFSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dCTP(4−) (CHEBI:61481) is a 2'-deoxyribonucleoside 5'-triphosphate(4−) (CHEBI:61560) |
| dCTP(4−) (CHEBI:61481) is conjugate base of dCTP(3−) (CHEBI:57724) |
| Incoming Relation(s) |
| dCTP(3−) (CHEBI:57724) is conjugate acid of dCTP(4−) (CHEBI:61481) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)cytidine |
| Synonyms | Source |
|---|---|
| 2'-deoxycytidine 5'-triphosphate(4−) | SUBMITTER |
| deoxycytidine triphosphate(4−) | SUBMITTER |
| dCTP tetraanion | ChEBI |
| 2'-deoxycytidine 5'-triphosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| dCTP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DCTP | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7844312 | Reaxys |