EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O13P3 |
| Net Charge | -3 |
| Average Mass | 464.133 |
| Monoisotopic Mass | 463.96777 |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/p-3/t5-,6+,8+/m0/s1 |
| InChIKey | RGWHQCVHVJXOKC-SHYZEUOFSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dCTP(3−) (CHEBI:57724) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dCTP(3−) (CHEBI:57724) is a 2'-deoxyribonucleoside triphosphate oxoanion (CHEBI:61662) |
| dCTP(3−) (CHEBI:57724) is conjugate acid of dCTP(4−) (CHEBI:61481) |
| dCTP(3−) (CHEBI:57724) is conjugate base of dCTP (CHEBI:16311) |
| Incoming Relation(s) |
| dCTP (CHEBI:16311) is conjugate acid of dCTP(3−) (CHEBI:57724) |
| dCTP(4−) (CHEBI:61481) is conjugate base of dCTP(3−) (CHEBI:57724) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]cytidine |
| Synonym | Source |
|---|---|
| dCTP trianion | ChEBI |