EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O2 |
| Net Charge | 0 |
| Average Mass | 296.495 |
| Monoisotopic Mass | 296.27153 |
| SMILES | CCCCCCC1CC1CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H36O2/c1-2-3-4-10-13-17-16-18(17)14-11-8-6-5-7-9-12-15-19(20)21/h17-18H,2-16H2,1H3,(H,20,21) |
| InChIKey | IJKRDVKGCQRKBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11,12-methyleneoctadecanoic acid (CHEBI:61456) is a carbocyclic fatty acid (CHEBI:35744) |
| 11,12-methyleneoctadecanoic acid (CHEBI:61456) is a long-chain fatty acid (CHEBI:15904) |
| 11,12-methyleneoctadecanoic acid (CHEBI:61456) is a saturated fatty acid (CHEBI:26607) |
| Incoming Relation(s) |
| lactobacillic acid (CHEBI:34811) is a 11,12-methyleneoctadecanoic acid (CHEBI:61456) |
| IUPAC Name |
|---|
| 10-(2-hexylcyclopropyl)decanoic acid |
| Synonyms | Source |
|---|---|
| acide methylene-11,12-octadecanoïque | ChEBI |
| 11,12-Methylenoctadecansäure | ChEBI |
| 11,12-methyleneoctadecanoic acids | ChEBI |
| 10-(2-hexylcyclopropyl)decanoic acids | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2331562 | Reaxys |