EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O2 |
| Net Charge | 0 |
| Average Mass | 296.495 |
| Monoisotopic Mass | 296.27153 |
| SMILES | CCCCCC[C@H]1C[C@H]1CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H36O2/c1-2-3-4-10-13-17-16-18(17)14-11-8-6-5-7-9-12-15-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18+/m0/s1 |
| InChIKey | IJKRDVKGCQRKBI-ZWKOTPCHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lactobacillic acid (CHEBI:34811) is a 11,12-methyleneoctadecanoic acid (CHEBI:61456) |
| IUPAC Name |
|---|
| 10-[(1R,2S)-2-hexylcyclopropyl]decanoic acid |
| Synonyms | Source |
|---|---|
| 11R,12S-Methylene-octadecanoic acid | KEGG COMPOUND |
| phytomonic acid | ChemIDplus |
| (1R,2S)-2-hexylcyclopropanedecanoic acid | ChEBI |
| (11R,12S)-lactobacillic acid | ChEBI |
| acide-methylene-11R,12S-octadecanoïque | ChEBI |
| (1R,2S)-1-(9'-carboxynon-1'-yl)-2-hexylcyclopropane | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C13838 | KEGG COMPOUND |
| LMFA01140001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2331563 | Reaxys |
| CAS:503-06-0 | ChemIDplus |
| Citations |
|---|