EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27ClN6O3 |
| Net Charge | 0 |
| Average Mass | 494.983 |
| Monoisotopic Mass | 494.18332 |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ncc2Cl)c1 |
| InChI | InChI=1S/C25H27ClN6O3/c1-4-23(33)28-17-6-5-7-19(14-17)35-24-20(26)16-27-25(30-24)29-21-9-8-18(15-22(21)34-3)32-12-10-31(2)11-13-32/h4-9,14-16H,1,10-13H2,2-3H3,(H,28,33)(H,27,29,30) |
| InChIKey | ITTRLTNMFYIYPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WZ4002 (CHEBI:61400) has role antineoplastic agent (CHEBI:35610) |
| WZ4002 (CHEBI:61400) has role tyrosine kinase inhibitor (CHEBI:38637) |
| WZ4002 (CHEBI:61400) is a organochlorine compound (CHEBI:36683) |
| WZ4002 (CHEBI:61400) is a piperazines (CHEBI:26144) |
| WZ4002 (CHEBI:61400) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| N-{3-[(5-chloro-2-{[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]amino}pyrimidin-4-yl)oxy]phenyl}prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| LSM-1085 | LINCS |
| Citations |
|---|