EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25ClFN5O3 |
| Net Charge | 0 |
| Average Mass | 485.947 |
| Monoisotopic Mass | 485.16300 |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C24H25ClFN5O3/c1-2-23(32)30-21-13-17-20(14-22(21)34-9-3-6-31-7-10-33-11-8-31)27-15-28-24(17)29-16-4-5-19(26)18(25)12-16/h2,4-5,12-15H,1,3,6-11H2,(H,30,32)(H,27,28,29) |
| InChIKey | OMZCMEYTWSXEPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| canertinib (CHEBI:61399) has role antineoplastic agent (CHEBI:35610) |
| canertinib (CHEBI:61399) has role tyrosine kinase inhibitor (CHEBI:38637) |
| canertinib (CHEBI:61399) is a monochlorobenzenes (CHEBI:83403) |
| canertinib (CHEBI:61399) is a morpholines (CHEBI:38785) |
| canertinib (CHEBI:61399) is a organofluorine compound (CHEBI:37143) |
| canertinib (CHEBI:61399) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| N-{4-[(3-chloro-4-fluorophenyl)amino]-7-[3-(morpholin-4-yl)propoxy]quinazolin-6-yl}prop-2-enamide |
| INN | Source |
|---|---|
| canertinib | ChemIDplus |
| Synonym | Source |
|---|---|
| CI-1033 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1120 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:267243-28-7 | ChemIDplus |
| Citations |
|---|