EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H29ClN6O3 |
| Net Charge | 0 |
| Average Mass | 557.054 |
| Monoisotopic Mass | 556.19897 |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C30H29ClN6O3/c1-4-39-28-16-25-23(15-26(28)36-29(38)9-7-13-37(2)3)30(20(17-32)18-34-25)35-21-10-11-27(24(31)14-21)40-19-22-8-5-6-12-33-22/h5-12,14-16,18H,4,13,19H2,1-3H3,(H,34,35)(H,36,38)/b9-7+ |
| InChIKey | JWNPDZNEKVCWMY-VQHVLOKHSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neratinib (CHEBI:61397) has role antineoplastic agent (CHEBI:35610) |
| neratinib (CHEBI:61397) has role tyrosine kinase inhibitor (CHEBI:38637) |
| neratinib (CHEBI:61397) is a nitrile (CHEBI:18379) |
| neratinib (CHEBI:61397) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| (2E)-N-(4-{[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]amino}-3-cyano-7-ethoxyquinolin-6-yl)-4-(dimethylamino)but-2-enamide |
| INN | Source |
|---|---|
| neratinib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| N-(4-(3-Chloro-4-(2-pyridinylmethoxy)anilino)-3-cyano-7-ethoxy-6-quinolyl)-4-(dimethylamino)-2-butenamide | ChemIDplus |
| HKI 272 | ChemIDplus |
| HKI-272 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08950 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9971763 | Reaxys |
| CAS:698387-09-6 | ChemIDplus |
| Citations |
|---|