EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO5 |
| Net Charge | 0 |
| Average Mass | 183.119 |
| Monoisotopic Mass | 183.01677 |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C7H5NO5/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | PPDRLQLKHRZIJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-nitrosalicylic acid (CHEBI:61281) is a 4-nitrophenols (CHEBI:88306) |
| 5-nitrosalicylic acid (CHEBI:61281) is a monohydroxybenzoic acid (CHEBI:25389) |
| 5-nitrosalicylic acid (CHEBI:61281) is conjugate acid of 5-nitrosalicylate (CHEBI:61268) |
| Incoming Relation(s) |
| 5-nitrosalicylate (CHEBI:61268) is conjugate base of 5-nitrosalicylic acid (CHEBI:61281) |
| IUPAC Name |
|---|
| 2-hydroxy-5-nitrobenzoic acid |
| Synonyms | Source |
|---|---|
| 5-nitro-2-hydroxybenzoic acid | ChemIDplus |
| anilotic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2213719 | Reaxys |
| CAS:96-97-9 | ChemIDplus |
| Citations |
|---|