EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4NO5 |
| Net Charge | -1 |
| Average Mass | 182.111 |
| Monoisotopic Mass | 182.00950 |
| SMILES | O=C([O-])c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C7H5NO5/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,9H,(H,10,11)/p-1 |
| InChIKey | PPDRLQLKHRZIJC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-nitrosalicylate (CHEBI:61268) is a monohydroxybenzoate (CHEBI:25388) |
| 5-nitrosalicylate (CHEBI:61268) is a salicylate (CHEBI:30762) |
| 5-nitrosalicylate (CHEBI:61268) is conjugate base of 5-nitrosalicylic acid (CHEBI:61281) |
| Incoming Relation(s) |
| 5-nitrosalicylic acid (CHEBI:61281) is conjugate acid of 5-nitrosalicylate (CHEBI:61268) |
| IUPAC Name |
|---|
| 2-hydroxy-5-nitrobenzoate |
| Synonym | Source |
|---|---|
| 5-nitrosalicylate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 5-nitrosalicylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12696 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3908298 | Reaxys |
| Citations |
|---|