EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N2O4 |
| Net Charge | 0 |
| Average Mass | 182.135 |
| Monoisotopic Mass | 182.03276 |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C7H6N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,8H2,(H,10,11) |
| InChIKey | RUCHWTKMOWXHLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-nitroanthranilic acid (CHEBI:61280) is a aminobenzoic acid (CHEBI:22495) |
| 5-nitroanthranilic acid (CHEBI:61280) is conjugate acid of 5-nitroanthranilate (CHEBI:61267) |
| Incoming Relation(s) |
| 5-nitroanthranilate (CHEBI:61267) is conjugate base of 5-nitroanthranilic acid (CHEBI:61280) |
| IUPAC Name |
|---|
| 2-amino-5-nitrobenzoic acid |
| Synonym | Source |
|---|---|
| 1-amino-2-carboxy-4-nitrobenzene | ChEBI |
| Citations |
|---|