EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5N2O4 |
| Net Charge | -1 |
| Average Mass | 181.127 |
| Monoisotopic Mass | 181.02548 |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)[O-] |
| InChI | InChI=1S/C7H6N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,8H2,(H,10,11)/p-1 |
| InChIKey | RUCHWTKMOWXHLU-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-nitroanthranilate (CHEBI:61267) is a anthranilate (CHEBI:16567) |
| 5-nitroanthranilate (CHEBI:61267) is conjugate base of 5-nitroanthranilic acid (CHEBI:61280) |
| Incoming Relation(s) |
| 5-nitroanthranilic acid (CHEBI:61280) is conjugate acid of 5-nitroanthranilate (CHEBI:61267) |
| IUPAC Name |
|---|
| 2-amino-5-nitrobenzoate |
| UniProt Name | Source |
|---|---|
| 5-nitroanthranilate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12695 | MetaCyc |
| Citations |
|---|