EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O4 |
| Net Charge | 0 |
| Average Mass | 280.279 |
| Monoisotopic Mass | 280.07356 |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)O)cccc2c1=O |
| InChI | InChI=1S/C17H12O4/c1-10-14(18)12-8-5-9-13(17(19)20)16(12)21-15(10)11-6-3-2-4-7-11/h2-9H,1H3,(H,19,20) |
| InChIKey | KMMBBZOSQNLLMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylflavone-8-carboxylic acid (CHEBI:61237) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| 3-methylflavone-8-carboxylic acid (CHEBI:61237) is a flavones (CHEBI:24043) |
| 3-methylflavone-8-carboxylic acid (CHEBI:61237) is a oxo monocarboxylic acid (CHEBI:35871) |
| Incoming Relation(s) |
| flavoxate (CHEBI:5088) has functional parent 3-methylflavone-8-carboxylic acid (CHEBI:61237) |
| IUPAC Name |
|---|
| 3-methyl-4-oxo-2-phenyl-4H-chromene-8-carboxylic acid |
| Synonyms | Source |
|---|---|
| 3-methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylic acid | ChemIDplus |
| 8-carboxy-3-methylflavone | ChemIDplus |
| Citations |
|---|