EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12NO3 |
| Net Charge | -1 |
| Average Mass | 146.166 |
| Monoisotopic Mass | 146.08227 |
| SMILES | CC[C@H](C)[C@H](NO)C(=O)[O-] |
| InChI | InChI=1S/C6H13NO3/c1-3-4(2)5(7-10)6(8)9/h4-5,7,10H,3H2,1-2H3,(H,8,9)/p-1/t4-,5-/m0/s1 |
| InChIKey | YEGAKLYOVHUQIJ-WHFBIAKZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-L-isoleucinate (CHEBI:61131) is a N-hydroxy-α-amino-acid anion (CHEBI:59258) |
| N-hydroxy-L-isoleucinate (CHEBI:61131) is a hydroxylamines (CHEBI:24709) |
| N-hydroxy-L-isoleucinate (CHEBI:61131) is a monocarboxylic acid anion (CHEBI:35757) |
| N-hydroxy-L-isoleucinate (CHEBI:61131) is conjugate base of N-hydroxy-L-isoleucine (CHEBI:61129) |
| Incoming Relation(s) |
| N-hydroxy-L-isoleucine (CHEBI:61129) is conjugate acid of N-hydroxy-L-isoleucinate (CHEBI:61131) |
| IUPAC Name |
|---|
| N-hydroxy-L-isoleucinate |
| Synonyms | Source |
|---|---|
| (2S,3S)-2-(hydroxyamino)-3-methylpentanoate | IUPAC |
| N-hydroxy-L-isoleucine(1−) | ChEBI |
| N-hydroxy-L-isoleucine anion | ChEBI |
| UniProt Name | Source |
|---|---|
| N-hydroxy-L-isoleucine | UniProt |