EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO3 |
| Net Charge | 0 |
| Average Mass | 147.174 |
| Monoisotopic Mass | 147.08954 |
| SMILES | CC[C@H](C)[C@H](NO)C(=O)O |
| InChI | InChI=1S/C6H13NO3/c1-3-4(2)5(7-10)6(8)9/h4-5,7,10H,3H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
| InChIKey | YEGAKLYOVHUQIJ-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-L-isoleucine (CHEBI:61129) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxy-L-isoleucine (CHEBI:61129) is a hydroxy-L-isoleucine (CHEBI:61130) |
| N-hydroxy-L-isoleucine (CHEBI:61129) is a hydroxylamines (CHEBI:24709) |
| N-hydroxy-L-isoleucine (CHEBI:61129) is conjugate acid of N-hydroxy-L-isoleucinate (CHEBI:61131) |
| Incoming Relation(s) |
| N-hydroxy-L-isoleucinate (CHEBI:61131) is conjugate base of N-hydroxy-L-isoleucine (CHEBI:61129) |
| IUPAC Name |
|---|
| N-hydroxy-L-isoleucine |