EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N3O3S |
| Net Charge | 0 |
| Average Mass | 265.294 |
| Monoisotopic Mass | 265.05211 |
| SMILES | O=S(=O)(Nc1ccccn1)c1ccc(NO)cc1 |
| InChI | InChI=1S/C11H11N3O3S/c15-13-9-4-6-10(7-5-9)18(16,17)14-11-3-1-2-8-12-11/h1-8,13,15H,(H,12,14) |
| InChIKey | AOXBYIPVNKSIPQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfapyridine hydroxylamine (CHEBI:61021) has functional parent sulfanilamide (CHEBI:45373) |
| sulfapyridine hydroxylamine (CHEBI:61021) has role allergen (CHEBI:50904) |
| sulfapyridine hydroxylamine (CHEBI:61021) has role drug metabolite (CHEBI:49103) |
| sulfapyridine hydroxylamine (CHEBI:61021) is a pyridines (CHEBI:26421) |
| sulfapyridine hydroxylamine (CHEBI:61021) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-(hydroxyamino)-N-(pyridin-2-yl)benzenesulfonamide |
| Citations |
|---|