EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H9NO |
| Net Charge | 0 |
| Average Mass | 75.111 |
| Monoisotopic Mass | 75.06841 |
| SMILES | CC(O)CN |
| InChI | InChI=1S/C3H9NO/c1-3(5)2-4/h3,5H,2,4H2,1H3 |
| InChIKey | HXKKHQJGJAFBHI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-aminopropan-2-ol (CHEBI:19030) has role Escherichia coli metabolite (CHEBI:76971) |
| 1-aminopropan-2-ol (CHEBI:19030) is a amino alcohol (CHEBI:22478) |
| 1-aminopropan-2-ol (CHEBI:19030) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 1-aminopropan-2-yl phosphate (CHEBI:19029) has functional parent 1-aminopropan-2-ol (CHEBI:19030) |
| diisopropanolamine (CHEBI:143266) has functional parent 1-aminopropan-2-ol (CHEBI:19030) |
| (2R)-1-aminopropan-2-ol (CHEBI:15675) is a 1-aminopropan-2-ol (CHEBI:19030) |
| IUPAC Name |
|---|
| 1-aminopropan-2-ol |
| Synonyms | Source |
|---|---|
| isopropanolamine | NIST Chemistry WebBook |
| 2-hydroxypropylamine | NIST Chemistry WebBook |
| monoisopropanolamine | NIST Chemistry WebBook |
| α-aminoisopropyl alcohol | NIST Chemistry WebBook |
| 1-methyl-2-aminoethanol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C05771 | KEGG COMPOUND |
| HMDB0012136 | HMDB |
| ECMDB04013 | ECMDB |
| 1-Amino-2-propanol | Wikipedia |
| Citations |
|---|