EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO2 |
| Net Charge | 0 |
| Average Mass | 133.191 |
| Monoisotopic Mass | 133.11028 |
| SMILES | CC(O)CNCC(C)O |
| InChI | InChI=1S/C6H15NO2/c1-5(8)3-7-4-6(2)9/h5-9H,3-4H2,1-2H3 |
| InChIKey | LVTYICIALWPMFW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. emulsifier The chemical role played by a substance that stabilizes an emulsion by increasing its kinetic stability. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diisopropanolamine (CHEBI:143266) has functional parent 1-aminopropan-2-ol (CHEBI:19030) |
| diisopropanolamine (CHEBI:143266) has role buffer (CHEBI:35225) |
| diisopropanolamine (CHEBI:143266) has role emulsifier (CHEBI:63046) |
| diisopropanolamine (CHEBI:143266) has role surfactant (CHEBI:35195) |
| diisopropanolamine (CHEBI:143266) is a aminodiol (CHEBI:22501) |
| diisopropanolamine (CHEBI:143266) is a secondary alcohol (CHEBI:35681) |
| diisopropanolamine (CHEBI:143266) is a secondary amino compound (CHEBI:50995) |
| IUPAC Names |
|---|
| 1,1'-azanediyldi(propan-2-ol) |
| 1,1'-iminodipropan-2-ol |
| Synonyms | Source |
|---|---|
| 1,1'-azanediylbis propan-2-ol | ChEBI |
| 1,1'-iminobis-2-propanol | ChemIDplus |
| 1,1'-iminodi-2-propanol | ChemIDplus |
| 1-[(2-hydroxypropyl)amino]propan-2-ol | ChEBI |
| bis(2-hydroxypropyl)amine | ChemIDplus |
| bis(2-propanol)amine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Diisopropanolamine | Wikipedia |
| Citations |
|---|