EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:143266 - diisopropanolamine
| Formula | C6H15NO2 |
| Net Charge | 0 |
| Average Mass | 133.191 |
| Monoisotopic Mass | 133.11028 |
| SMILES | CC(O)CNCC(C)O |
| InChI | InChI=1S/C6H15NO2/c1-5(8)3-7-4-6(2)9/h5-9H,3-4H2,1-2H3 |
| InChIKey | LVTYICIALWPMFW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. emulsifier The chemical role played by a substance that stabilizes an emulsion by increasing its kinetic stability. surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diisopropanolamine (CHEBI:143266) has functional parent 1-aminopropan-2-ol (CHEBI:19030) |
| diisopropanolamine (CHEBI:143266) has role buffer (CHEBI:35225) |
| diisopropanolamine (CHEBI:143266) has role emulsifier (CHEBI:63046) |
| diisopropanolamine (CHEBI:143266) has role surfactant (CHEBI:35195) |
| diisopropanolamine (CHEBI:143266) is a aminodiol (CHEBI:22501) |
| diisopropanolamine (CHEBI:143266) is a secondary alcohol (CHEBI:35681) |
| diisopropanolamine (CHEBI:143266) is a secondary amino compound (CHEBI:50995) |
| IUPAC Names |
|---|
| 1,1'-iminodipropan-2-ol |
| 1,1'-azanediyldi(propan-2-ol) |
| Synonyms | Source |
|---|---|
| bis(2-hydroxypropyl)amine | ChemIDplus |
| DIPA | ChEBI |
| 1,1'-iminobis-2-propanol | ChemIDplus |
| 1,1'-iminodi-2-propanol | ChemIDplus |
| di-2-propanolamine | NIST Chemistry WebBook |
| N,N-bis(2-hydroxypropyl)amine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Diisopropanolamine | Wikipedia |
| Citations |
|---|