EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H9NO |
| Net Charge | 0 |
| Average Mass | 75.111 |
| Monoisotopic Mass | 75.06841 |
| SMILES | C[C@@H](O)CN |
| InChI | InChI=1S/C3H9NO/c1-3(5)2-4/h3,5H,2,4H2,1H3/t3-/m1/s1 |
| InChIKey | HXKKHQJGJAFBHI-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-1-aminopropan-2-ol (CHEBI:15675) is a 1-aminopropan-2-ol (CHEBI:19030) |
| (2R)-1-aminopropan-2-ol (CHEBI:15675) is conjugate base of (2R)-2-hydroxypropylammonium (CHEBI:42677) |
| Incoming Relation(s) |
| (2R)-2-hydroxypropylammonium (CHEBI:42677) is conjugate acid of (2R)-1-aminopropan-2-ol (CHEBI:15675) |
| IUPAC Name |
|---|
| (2R)-1-aminopropan-2-ol |
| Synonyms | Source |
|---|---|
| (2R)-(−)-2-hydroxypropylamine | ChEBI |
| (2R)-(−)-hydroxypropylamine | ChEBI |
| (R)-(−)-1-amino-2-propanol | ChEBI |
| (R)-(−)-1-aminopropan-2-ol | ChemIDplus |
| (R)-1-amino-2-propanol | ChEBI |
| (R)-1-Amino-2-propanol | KEGG COMPOUND |