EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6099 - kaempferide
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| InChIKey | SQFSKOYWJBQGKQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferide (CHEBI:6099) has functional parent kaempferol (CHEBI:28499) |
| kaempferide (CHEBI:6099) has role antihypertensive agent (CHEBI:35674) |
| kaempferide (CHEBI:6099) has role metabolite (CHEBI:25212) |
| kaempferide (CHEBI:6099) is a 7-hydroxyflavonol (CHEBI:52267) |
| kaempferide (CHEBI:6099) is a monomethoxyflavone (CHEBI:25401) |
| kaempferide (CHEBI:6099) is a trihydroxyflavone (CHEBI:27116) |
| kaempferide (CHEBI:6099) is conjugate acid of kaempferide(1−) (CHEBI:58925) |
| Incoming Relation(s) |
| 8-(1,1-dimethylallyl)kaempferide (CHEBI:2301) has functional parent kaempferide (CHEBI:6099) |
| kaempferide(1−) (CHEBI:58925) is conjugate base of kaempferide (CHEBI:6099) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 1.3,5,7-Trihydroxy-2-(4-methoxyphenyl)-4-benzopyrone | HMDB |
| 4'-O-Methylkaempferol | HMDB |
| Campheride | HMDB |
| Kaempferide | KEGG COMPOUND |
| Kaempferol 4'-methyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001060 | KNApSAcK |
| C10098 | KEGG COMPOUND |
| CPD-7252 | MetaCyc |
| HMDB0037441 | HMDB |
| Kaempferide | Wikipedia |
| KR20110062726 | Patent |
| LMPK12110563 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:305378 | Reaxys |
| CAS:491-54-3 | KEGG COMPOUND |
| CAS:491-54-3 | ChemIDplus |
| Citations |
|---|