EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O6 |
| Net Charge | 0 |
| Average Mass | 368.385 |
| Monoisotopic Mass | 368.12599 |
| SMILES | C=CC(C)(C)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(OC)cc3)oc12 |
| InChI | InChI=1S/C21H20O6/c1-5-21(2,3)16-14(23)10-13(22)15-17(24)18(25)19(27-20(15)16)11-6-8-12(26-4)9-7-11/h5-10,22-23,25H,1H2,2-4H3 |
| InChIKey | ZETKATWNOCCPNF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(1,1-dimethylallyl)kaempferide (CHEBI:2301) has functional parent kaempferide (CHEBI:6099) |
| 8-(1,1-dimethylallyl)kaempferide (CHEBI:2301) has role plant metabolite (CHEBI:76924) |
| 8-(1,1-dimethylallyl)kaempferide (CHEBI:2301) is a 7-hydroxyflavonol (CHEBI:52267) |
| 8-(1,1-dimethylallyl)kaempferide (CHEBI:2301) is a monomethoxyflavone (CHEBI:25401) |
| 8-(1,1-dimethylallyl)kaempferide (CHEBI:2301) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-methoxyphenyl)-8-(2-methylbut-3-en-2-yl)-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3,5,7-trihydroxy-4'-methoxy-8-(1,1-dimethylprop-2-en-1-yl)flavone | ChEBI |
| 8-(1,1-DMA)kaempferide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00005004 | KNApSAcK |
| C11580 | KEGG COMPOUND |
| LMPK12110560 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3569838 | Reaxys |