EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29O3 |
| Net Charge | -1 |
| Average Mass | 293.427 |
| Monoisotopic Mass | 293.21222 |
| SMILES | CCCCC/C=C\C=C\O/C=C/CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-7-10-13-16-21-17-14-11-8-6-9-12-15-18(19)20/h7,10,13-14,16-17H,2-6,8-9,11-12,15H2,1H3,(H,19,20)/p-1/b10-7-,16-13+,17-14+ |
| InChIKey | HHZKKFXQEIBVEV-CXXUKANQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colneleate (CHEBI:60957) is a long-chain fatty acid anion (CHEBI:57560) |
| colneleate (CHEBI:60957) is a oxa fatty acid anion (CHEBI:61413) |
| colneleate (CHEBI:60957) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| colneleate (CHEBI:60957) is a straight-chain fatty acid anion (CHEBI:59203) |
| colneleate (CHEBI:60957) is conjugate base of colneleic acid (CHEBI:60956) |
| Incoming Relation(s) |
| colneleic acid (CHEBI:60956) is conjugate acid of colneleate (CHEBI:60957) |
| IUPAC Name |
|---|
| (8E)-9-[(1E,3Z)-nona-1,3-dien-1-yloxy]non-8-enoate |
| Synonyms | Source |
|---|---|
| (8E,1'E,3'Z)-9-(1',3'-nonadienyloxy)-8-nonenoate | ChEBI |
| colneleate anion | ChEBI |
| colneleic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| colneleate | UniProt |
| Citations |
|---|