EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCC/C=C\C=C\O/C=C/CCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-7-10-13-16-21-17-14-11-8-6-9-12-15-18(19)20/h7,10,13-14,16-17H,2-6,8-9,11-12,15H2,1H3,(H,19,20)/b10-7-,16-13+,17-14+ |
| InChIKey | HHZKKFXQEIBVEV-CXXUKANQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colneleic acid (CHEBI:60956) is a divinyl ether fatty acid (CHEBI:61411) |
| colneleic acid (CHEBI:60956) is a long-chain fatty acid (CHEBI:15904) |
| colneleic acid (CHEBI:60956) is a straight-chain fatty acid (CHEBI:59202) |
| colneleic acid (CHEBI:60956) is conjugate acid of colneleate (CHEBI:60957) |
| Incoming Relation(s) |
| colneleate (CHEBI:60957) is conjugate base of colneleic acid (CHEBI:60956) |
| IUPAC Name |
|---|
| (8E)-9-[(1E,3Z)-nona-1,3-dien-1-yloxy]non-8-enoic acid |
| Synonyms | Source |
|---|---|
| (8E,1'E,3'Z)-9-(1',3'-nonadienyloxy)-8-nonenoic acid | ChEBI |
| 9-oxa-8t10t12c-18:3 | ChEBI |
| 9-oxa-8t10t12c-C18:3 | ChEBI |
| Colneleinsäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3547052 | Reaxys |
| CAS:52761-34-9 | ChemIDplus |
| Citations |
|---|