EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27NO4 |
| Net Charge | 0 |
| Average Mass | 309.406 |
| Monoisotopic Mass | 309.19401 |
| SMILES | CC(C)(C)NC[C@@H](O)COc1cccc2c1C[C@@H](O)[C@@H](O)C2 |
| InChI | InChI=1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3/t12-,14+,15-/m1/s1 |
| InChIKey | VWPOSFSPZNDTMJ-VHDGCEQUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R,2'R)-nadolol (CHEBI:60920) is a aromatic ether (CHEBI:35618) |
| (2S,3R,2'R)-nadolol (CHEBI:60920) is a secondary amino compound (CHEBI:50995) |
| (2S,3R,2'R)-nadolol (CHEBI:60920) is a triol (CHEBI:27136) |
| (2S,3R,2'R)-nadolol (CHEBI:60920) is enantiomer of (2R,3S,2'S)-nadolol (CHEBI:60922) |
| Incoming Relation(s) |
| nadolol (CHEBI:7444) has part (2S,3R,2'R)-nadolol (CHEBI:60920) |
| (2R,3S,2'S)-nadolol (CHEBI:60922) is enantiomer of (2S,3R,2'R)-nadolol (CHEBI:60920) |
| IUPAC Name |
|---|
| (2S,3R)-5-{[(2R)-3-(tert-butylamino)-2-hydroxypropyl]oxy}-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7518267 | Reaxys |