EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N2O10 |
| Net Charge | 0 |
| Average Mass | 504.492 |
| Monoisotopic Mass | 504.17440 |
| SMILES | Cc1ccc(N(CC(=O)O)CC(=O)O)c(OCCOc2cc(C)ccc2N(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C24H28N2O10/c1-15-3-5-17(25(11-21(27)28)12-22(29)30)19(9-15)35-7-8-36-20-10-16(2)4-6-18(20)26(13-23(31)32)14-24(33)34/h3-6,9-10H,7-8,11-14H2,1-2H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | BOMWLYNXTGNSSE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5'-dimethyl-BAPTA (CHEBI:60889) has functional parent BAPTA (CHEBI:60888) |
| 5,5'-dimethyl-BAPTA (CHEBI:60889) has role chelator (CHEBI:38161) |
| 5,5'-dimethyl-BAPTA (CHEBI:60889) is a polyamino carboxylic acid (CHEBI:60892) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-{ethane-1,2-diylbis[oxy(4-methyl-2,1-phenylene)nitrilo]}tetraacetic acid |
| Synonyms | Source |
|---|---|
| 5,5'-Dimethyl-bapta | ChemIDplus |
| 5,5'-Dimethyl-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetate | ChemIDplus |
| Bis(2-amino-5-methylphenoxy)ethane-N,N,N',N'-tetraacetate | ChemIDplus |
| (CH3)2-Bapta | ChemIDplus |
| Dimethyl bis-(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid | ChemIDplus |
| Maptam | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:91416-19-2 | ChemIDplus |