EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O10 |
| Net Charge | 0 |
| Average Mass | 476.438 |
| Monoisotopic Mass | 476.14309 |
| SMILES | O=C(O)CN(CC(=O)O)c1ccccc1OCCOc1ccccc1N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C22H24N2O10/c25-19(26)11-23(12-20(27)28)15-5-1-3-7-17(15)33-9-10-34-18-8-4-2-6-16(18)24(13-21(29)30)14-22(31)32/h1-8H,9-14H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | FTEDXVNDVHYDQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAPTA (CHEBI:60888) has role chelator (CHEBI:38161) |
| BAPTA (CHEBI:60888) is a polyamino carboxylic acid (CHEBI:60892) |
| BAPTA (CHEBI:60888) is a tetracarboxylic acid (CHEBI:35742) |
| Incoming Relation(s) |
| 5,5'-dibromo-BAPTA (CHEBI:60890) has functional parent BAPTA (CHEBI:60888) |
| 5,5'-dimethyl-BAPTA (CHEBI:60889) has functional parent BAPTA (CHEBI:60888) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-[ethane-1,2-diylbis(oxy-2,1-phenylenenitrilo)]tetraacetic acid |
| Synonyms | Source |
|---|---|
| 1,2-Bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid | ChemIDplus |
| 1,2-Bis(o-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid | ChemIDplus |
| Bapeta | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5192406 | Reaxys |
| CAS:85233-19-8 | ChemIDplus |