EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5O3 |
| Net Charge | -1 |
| Average Mass | 113.092 |
| Monoisotopic Mass | 113.02442 |
| SMILES | [H]/C(C=C)=C(\O)C(=O)[O-] |
| InChI | InChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2-3,6H,1H2,(H,7,8)/p-1/b4-3+ |
| InChIKey | VHTQQDXPNUTMNB-ONEGZZNKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-2-hydroxypenta-2,4-dienoate (CHEBI:60886) is a 2-hydroxy fatty acid anion (CHEBI:76176) |
| (2E)-2-hydroxypenta-2,4-dienoate (CHEBI:60886) is a 2-hydroxypenta-2,4-dienoate (CHEBI:37319) |
| (2E)-2-hydroxypenta-2,4-dienoate (CHEBI:60886) is conjugate base of cis-2-hydroxypenta-2,4-dienoic acid (CHEBI:1113) |
| Incoming Relation(s) |
| cis-2-hydroxypenta-2,4-dienoic acid (CHEBI:1113) is conjugate acid of (2E)-2-hydroxypenta-2,4-dienoate (CHEBI:60886) |
| IUPAC Name |
|---|
| (2E)-2-hydroxypenta-2,4-dienoate |
| Synonym | Source |
|---|---|
| cis-2-hydroxypenta-2,4-dienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E)-2-hydroxypenta-2,4-dienoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-6761 | MetaCyc |