EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10NO4 |
| Net Charge | -1 |
| Average Mass | 232.215 |
| Monoisotopic Mass | 232.06153 |
| SMILES | Nc1ccccc1C(=O)/C=C/C=C(/O)C(=O)[O-] |
| InChI | InChI=1S/C12H11NO4/c13-9-5-2-1-4-8(9)10(14)6-3-7-11(15)12(16)17/h1-7,15H,13H2,(H,16,17)/p-1/b6-3+,11-7+ |
| InChIKey | AFPIGEHQFVBSJA-ACIWFXKJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:60885) is a 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:36537) |
| (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:60885) is conjugate base of (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:61027) |
| Incoming Relation(s) |
| (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:61027) is conjugate acid of (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:60885) |
| IUPAC Name |
|---|
| (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate |
| Synonym | Source |
|---|---|
| (E,E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12502 | MetaCyc |
| Citations |
|---|