EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10NO4 |
| Net Charge | -1 |
| Average Mass | 232.215 |
| Monoisotopic Mass | 232.06153 |
| SMILES | [H]C(=CC([H])=C(O)C(=O)[O-])C(=O)c1ccccc1N |
| InChI | InChI=1S/C12H11NO4/c13-9-5-2-1-4-8(9)10(14)6-3-7-11(15)12(16)17/h1-7,15H,13H2,(H,16,17)/p-1 |
| InChIKey | AFPIGEHQFVBSJA-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:36537) is a 6-oxo monocarboxylic acid anion (CHEBI:35976) |
| 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:36537) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:36537) is conjugate base of 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:197289) |
| Incoming Relation(s) |
| (2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:60885) is a 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:36537) |
| 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:197289) is conjugate acid of 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:36537) |
| IUPAC Name |
|---|
| 6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-6-oxo-(2'-aminophenyl)-hexa-2,4-dienoate | KEGG COMPOUND |
| 6-(2-aminophenyl)-6-oxo-2-hydroxy-2,4-hexadienoic acid(1−) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08062 | KEGG COMPOUND |