EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O8P |
| Net Charge | -1 |
| Average Mass | 305.159 |
| Monoisotopic Mass | 305.01803 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@H]3OP(=O)([O-])O[C@H]32)c(=O)n1 |
| InChI | InChI=1S/C9H11N2O8P/c12-3-4-6-7(19-20(15,16)18-6)8(17-4)11-2-1-5(13)10-9(11)14/h1-2,4,6-8,12H,3H2,(H,15,16)(H,10,13,14)/p-1/t4-,6-,7-,8-/m1/s1 |
| InChIKey | HWDMHJDYMFRXOX-XVFCMESISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',3'-cyclic UMP(1−) (CHEBI:60873) has role human metabolite (CHEBI:77746) |
| 2',3'-cyclic UMP(1−) (CHEBI:60873) is a 2',3'-cyclic nucleotide(1−) (CHEBI:66954) |
| 2',3'-cyclic UMP(1−) (CHEBI:60873) is conjugate base of 2',3'-cyclic UMP (CHEBI:28637) |
| Incoming Relation(s) |
| 2',3'-cyclic UMP (CHEBI:28637) is conjugate acid of 2',3'-cyclic UMP(1−) (CHEBI:60873) |
| IUPAC Name |
|---|
| uridine 2',3'-phosphate |
| UniProt Name | Source |
|---|---|
| 2',3'-cyclophospho-UMP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-3725 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3915271 | Reaxys |