EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O8P |
| Net Charge | 0 |
| Average Mass | 306.167 |
| Monoisotopic Mass | 306.02530 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]32)c(=O)n1 |
| InChI | InChI=1S/C9H11N2O8P/c12-3-4-6-7(19-20(15,16)18-6)8(17-4)11-2-1-5(13)10-9(11)14/h1-2,4,6-8,12H,3H2,(H,15,16)(H,10,13,14)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | HWDMHJDYMFRXOX-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',3'-cyclic UMP (CHEBI:28637) has role Escherichia coli metabolite (CHEBI:76971) |
| 2',3'-cyclic UMP (CHEBI:28637) is a 2',3'-cyclic pyrimidine nucleotide (CHEBI:19218) |
| 2',3'-cyclic UMP (CHEBI:28637) is conjugate acid of 2',3'-cyclic UMP(1−) (CHEBI:60873) |
| Incoming Relation(s) |
| 2',3'-cyclic UMP(1−) (CHEBI:60873) is conjugate base of 2',3'-cyclic UMP (CHEBI:28637) |
| IUPAC Name |
|---|
| uridine 2',3'-(hydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 2',3'-Cyclic UMP | KEGG COMPOUND |
| cUMP | ChEBI |
| Uridine 2',3'-cyclophosphate | ChemIDplus |
| Uridine, cyclic 2',3'-(hydrogen phosphate) | ChemIDplus |