EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H38Cl2N8O4 |
| Net Charge | 0 |
| Average Mass | 705.647 |
| Monoisotopic Mass | 704.23931 |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@H]5CO[C@](Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C35H38Cl2N8O4/c1-3-25(2)45-34(46)44(24-40-45)29-7-5-27(6-8-29)41-14-16-42(17-15-41)28-9-11-30(12-10-28)47-19-31-20-48-35(49-31,21-43-23-38-22-39-43)32-13-4-26(36)18-33(32)37/h4-13,18,22-25,31H,3,14-17,19-21H2,1-2H3/t25?,31-,35-/m0/s1 |
| InChIKey | VHVPQPYKVGDNFY-ZPGVKDDISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. Hedgehog signaling pathway inhibitor Any pathway inhibitor that inhibits the Hedgehog signalling pathway. EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of xenobiotic-transporting ATPase (EC 3.6.3.44). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| itraconazole (CHEBI:6076) has role EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor (CHEBI:77748) |
| itraconazole (CHEBI:6076) has role Hedgehog signaling pathway inhibitor (CHEBI:140921) |
| itraconazole (CHEBI:6076) has role P450 inhibitor (CHEBI:50183) |
| itraconazole (CHEBI:6076) is a N-arylpiperazine (CHEBI:46848) |
| itraconazole (CHEBI:6076) is a aromatic ether (CHEBI:35618) |
| itraconazole (CHEBI:6076) is a conazole antifungal drug (CHEBI:87071) |
| itraconazole (CHEBI:6076) is a cyclic ketal (CHEBI:59779) |
| itraconazole (CHEBI:6076) is a dichlorobenzene (CHEBI:23697) |
| itraconazole (CHEBI:6076) is a dioxolane (CHEBI:39430) |
| itraconazole (CHEBI:6076) is a triazole antifungal drug (CHEBI:87101) |
| itraconazole (CHEBI:6076) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 2-(butan-2-yl)-4-{4-[4-(4-{[(2R,4S)-2-(2,4-dichlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-2,4-dihydro-3H-1,2,4-triazol-3-one |
| Synonyms | Source |
|---|---|
| Itraconazole | KEGG DRUG |
| Itrizole (TN) | KEGG DRUG |
| Oriconazole | ChemIDplus |
| Sporanox (TN) | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| itraconazole | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:84625-61-6 | ChemIDplus |
| CAS:84625-61-6 | KEGG DRUG |
| Citations |
|---|