EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O2 |
| Net Charge | 0 |
| Average Mass | 102.133 |
| Monoisotopic Mass | 102.06808 |
| SMILES | CC(C)CC(=O)O |
| InChI | InChI=1S/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| InChIKey | GWYFCOCPABKNJV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isovaleric acid (CHEBI:28484) has role mammalian metabolite (CHEBI:75768) |
| isovaleric acid (CHEBI:28484) has role plant metabolite (CHEBI:76924) |
| isovaleric acid (CHEBI:28484) is a branched-chain saturated fatty acid (CHEBI:39417) |
| isovaleric acid (CHEBI:28484) is a methylbutyric acid (CHEBI:38653) |
| isovaleric acid (CHEBI:28484) is a short-chain fatty acid (CHEBI:26666) |
| isovaleric acid (CHEBI:28484) is conjugate acid of isovalerate (CHEBI:48942) |
| Incoming Relation(s) |
| (E)-2-(methoxyimino)-3-methylbutanoic acid (CHEBI:131390) has functional parent isovaleric acid (CHEBI:28484) |
| N-isovaleryl-L-alanine (CHEBI:136818) has functional parent isovaleric acid (CHEBI:28484) |
| O-isovalerylcarnitine (CHEBI:73025) has functional parent isovaleric acid (CHEBI:28484) |
| 2-(4-chlorophenyl)-3-methylbutyric acid (CHEBI:39345) has functional parent isovaleric acid (CHEBI:28484) |
| 2-(4-hydroxyphenyl)-3-methylbutyric acid (CHEBI:39359) has functional parent isovaleric acid (CHEBI:28484) |
| 2-hexenyl isovalerate (CHEBI:176332) has functional parent isovaleric acid (CHEBI:28484) |
| 2-hydroxy-3-methylbutyric acid (CHEBI:60645) has functional parent isovaleric acid (CHEBI:28484) |
| 2,2-dihydroxy-3-methylbutanoic acid (CHEBI:167881) has functional parent isovaleric acid (CHEBI:28484) |
| 2,3-dihydroxy-3-methylbutanoic acid (CHEBI:15689) has functional parent isovaleric acid (CHEBI:28484) |
| 3-hexenyl isovalerate (CHEBI:194237) has functional parent isovaleric acid (CHEBI:28484) |
| 3-hydroxyisovaleric acid (CHEBI:37084) has functional parent isovaleric acid (CHEBI:28484) |
| 3-methylbutaneperoxoic acid (CHEBI:229586) has functional parent isovaleric acid (CHEBI:28484) |
| ananolignan J (CHEBI:67447) has functional parent isovaleric acid (CHEBI:28484) |
| ethyl isovalerate (CHEBI:31571) has functional parent isovaleric acid (CHEBI:28484) |
| isovaleryl-CoA (CHEBI:15487) has functional parent isovaleric acid (CHEBI:28484) |
| neurolenin A (CHEBI:66620) has functional parent isovaleric acid (CHEBI:28484) |
| neurolenin B (CHEBI:66621) has functional parent isovaleric acid (CHEBI:28484) |
| neurolenin C (CHEBI:66622) has functional parent isovaleric acid (CHEBI:28484) |
| neurolenin D (CHEBI:66623) has functional parent isovaleric acid (CHEBI:28484) |
| isovalerate (CHEBI:48942) is conjugate base of isovaleric acid (CHEBI:28484) |
| IUPAC Name |
|---|
| 3-methylbutanoic acid |
| Synonyms | Source |
|---|---|
| 3-Methylbutanoic acid | KEGG COMPOUND |
| 3-Methylbuttersäure | ChEBI |
| 3-methylbutyric acid | NIST Chemistry WebBook |
| 3-methyl-n-butyric acid | ChEBI |
| delphinic acid | ChemIDplus |
| isobutylformic acid | ChemIDplus |
| Citations |
|---|