EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | [H]C(CCC)=C([H])COC(=O)CC(C)C |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-8-13-11(12)9-10(2)3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | SAVRWHQEMHIAEB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mentha x piperita (ncbitaxon:34256) | - | PubMed (30067803) |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hexenyl isovalerate (CHEBI:176332) has functional parent 2-hexen-1-ol (CHEBI:144070) |
| 2-hexenyl isovalerate (CHEBI:176332) has functional parent isovaleric acid (CHEBI:28484) |
| 2-hexenyl isovalerate (CHEBI:176332) has role volatile oil component (CHEBI:27311) |
| 2-hexenyl isovalerate (CHEBI:176332) is a fatty acid ester (CHEBI:35748) |
| Incoming Relation(s) |
| (2E)-2-hexenyl isovalerate (CHEBI:172052) is a 2-hexenyl isovalerate (CHEBI:176332) |
| IUPAC Name |
|---|
| hex-2-en-1-yl 3-methylbutanoate |
| Synonyms | Source |
|---|---|
| 2-hexenyl 3-methylbutanoate | ChEBI |
| 2-hexenyl 3-methylbutyrate | ChEBI |
| hex-2-en-1-yl 3-methylbutanoate | ChEBI |
| hex-2-en-1-yl 3-methylbutyrate | ChEBI |
| hex-2-en-1-yl isovalerate | ChEBI |
| hex-2-enyl 3-methylbutanoate | ChEBI |
| Citations |
|---|