EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13ClO2 |
| Net Charge | 0 |
| Average Mass | 212.676 |
| Monoisotopic Mass | 212.06041 |
| SMILES | CC(C)C(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClO2/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8/h3-7,10H,1-2H3,(H,13,14) |
| InChIKey | VTJMSIIXXKNIDJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-chlorophenyl)-3-methylbutyric acid (CHEBI:39345) has functional parent isovaleric acid (CHEBI:28484) |
| 2-(4-chlorophenyl)-3-methylbutyric acid (CHEBI:39345) is a monocarboxylic acid (CHEBI:25384) |
| 2-(4-chlorophenyl)-3-methylbutyric acid (CHEBI:39345) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| fenvalerate (CHEBI:5014) has functional parent 2-(4-chlorophenyl)-3-methylbutyric acid (CHEBI:39345) |
| IUPAC Name |
|---|
| 2-(4-chlorophenyl)-3-methylbutanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:2012-74-0 | ChemIDplus |