EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CCCC(O)C(=O)O |
| InChI | InChI=1S/C5H10O3/c1-2-3-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChIKey | JRHWHSJDIILJAT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypentanoic acid (CHEBI:60647) has functional parent valeric acid (CHEBI:17418) |
| 2-hydroxypentanoic acid (CHEBI:60647) has role algal metabolite (CHEBI:84735) |
| 2-hydroxypentanoic acid (CHEBI:60647) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 2-hydroxypentanoic acid (CHEBI:60647) is conjugate acid of 2-hydroxypentanoate (CHEBI:60630) |
| Incoming Relation(s) |
| 2-hydroxypentanoyl-L-carnitine (CHEBI:85104) has functional parent 2-hydroxypentanoic acid (CHEBI:60647) |
| 2-hydroxypentanoate (CHEBI:60630) is conjugate base of 2-hydroxypentanoic acid (CHEBI:60647) |
| IUPAC Name |
|---|
| 2-hydroxypentanoic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxyvaleric acid | ChemIDplus |
| α-hydroxy-n-valeric acid | ChEBI |
| α-hydroxyvaleric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001863 | HMDB |
| LMFA01050007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721166 | Reaxys |
| CAS:617-31-2 | ChemIDplus |
| Citations |
|---|