EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O3 |
| Net Charge | -1 |
| Average Mass | 117.124 |
| Monoisotopic Mass | 117.05572 |
| SMILES | CCCC(O)C(=O)[O-] |
| InChI | InChI=1S/C5H10O3/c1-2-3-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/p-1 |
| InChIKey | JRHWHSJDIILJAT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypentanoate (CHEBI:60630) has role metabolite (CHEBI:25212) |
| 2-hydroxypentanoate (CHEBI:60630) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 2-hydroxypentanoate (CHEBI:60630) is conjugate base of 2-hydroxypentanoic acid (CHEBI:60647) |
| Incoming Relation(s) |
| (2R)-hydroxypentanoate (CHEBI:232385) is a 2-hydroxypentanoate (CHEBI:60630) |
| 2-hydroxypentanoic acid (CHEBI:60647) is conjugate acid of 2-hydroxypentanoate (CHEBI:60630) |
| Synonyms | Source |
|---|---|
| alpha hydroxy valerate | ChEBI |
| α-hydroxyvalerate | ChEBI |
| α-hydroxy-n-valerate | ChEBI |
| 2-hydroxyvalerate | ChEBI |
| Citations |
|---|