EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O11P2 |
| Net Charge | -3 |
| Average Mass | 385.138 |
| Monoisotopic Mass | 384.98545 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])[O-])O2)c(=O)n1 |
| InChI | InChI=1S/C9H14N2O11P2/c12-5-3-8(11-2-1-7(13)10-9(11)14)21-6(5)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,10,13,14)(H2,15,16,17)/p-3/t5-,6+,8+/m0/s1 |
| InChIKey | QHWZTVCCBMIIKE-SHYZEUOFSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUDP(3−) (CHEBI:60471) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dUDP(3−) (CHEBI:60471) has role human metabolite (CHEBI:77746) |
| dUDP(3−) (CHEBI:60471) is a 2'-deoxyribonucleoside 5'-diphosphate(3−) (CHEBI:73316) |
| dUDP(3−) (CHEBI:60471) is conjugate base of dUDP (CHEBI:28850) |
| Incoming Relation(s) |
| dUDP (CHEBI:28850) is conjugate acid of dUDP(3−) (CHEBI:60471) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-[(phosphonatooxy)phosphinato]uridine |
| Synonyms | Source |
|---|---|
| 2'-deoxyuridine 5'-diphosphate(3−) | ChEBI |
| 2'-deoxyuridine 5'-diphosphate trianion | ChEBI |
| dUDP trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| dUDP | UniProt |