EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O11P2 |
| Net Charge | 0 |
| Average Mass | 388.162 |
| Monoisotopic Mass | 388.00728 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H14N2O11P2/c12-5-3-8(11-2-1-7(13)10-9(11)14)21-6(5)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
| InChIKey | QHWZTVCCBMIIKE-SHYZEUOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUDP (CHEBI:28850) has role Escherichia coli metabolite (CHEBI:76971) |
| dUDP (CHEBI:28850) has role mouse metabolite (CHEBI:75771) |
| dUDP (CHEBI:28850) is a deoxyuridine phosphate (CHEBI:23641) |
| dUDP (CHEBI:28850) is a pyrimidine 2'-deoxyribonucleoside 5'-diphosphate (CHEBI:37037) |
| dUDP (CHEBI:28850) is conjugate acid of dUDP(3−) (CHEBI:60471) |
| Incoming Relation(s) |
| dUDP(3−) (CHEBI:60471) is conjugate base of dUDP (CHEBI:28850) |
| IUPAC Name |
|---|
| 2'-deoxyuridine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 2'-Deoxyuridine 5'-diphosphate | KEGG COMPOUND |
| dUDP | KEGG COMPOUND |