EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO2 |
| Net Charge | 0 |
| Average Mass | 141.170 |
| Monoisotopic Mass | 141.07898 |
| SMILES | CC[C@]1(C)CC(=O)NC1=O |
| InChI | InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10)/t7-/m1/s1 |
| InChIKey | HAPOVYFOVVWLRS-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Biological Role: | T-type calcium channel blocker Any agent that interferes with the activity of T-type calcium channels. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-ethosuximide (CHEBI:60354) is a ethosuximide (CHEBI:4887) |
| (R)-ethosuximide (CHEBI:60354) is enantiomer of (S)-ethosuximide (CHEBI:60355) |
| Incoming Relation(s) |
| (S)-ethosuximide (CHEBI:60355) is enantiomer of (R)-ethosuximide (CHEBI:60354) |
| IUPAC Name |
|---|
| (3R)-3-ethyl-3-methylpyrrolidine-2,5-dione |
| Synonyms | Source |
|---|---|
| (−)-ethosuximide | ChEBI |
| (R)-2-methyl-2-ethylsuccinimide | ChEBI |
| (R)-(−)-ethosuximide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8036513 | Reaxys |