EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO2 |
| Net Charge | 0 |
| Average Mass | 141.170 |
| Monoisotopic Mass | 141.07898 |
| SMILES | CCC1(C)CC(=O)NC1=O |
| InChI | InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | HAPOVYFOVVWLRS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | T-type calcium channel blocker Any agent that interferes with the activity of T-type calcium channels. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethosuximide (CHEBI:4887) has role anticonvulsant (CHEBI:35623) |
| ethosuximide (CHEBI:4887) has role geroprotector (CHEBI:176497) |
| ethosuximide (CHEBI:4887) has role T-type calcium channel blocker (CHEBI:194338) |
| ethosuximide (CHEBI:4887) is a dicarboximide (CHEBI:35356) |
| ethosuximide (CHEBI:4887) is a pyrrolidinone (CHEBI:38275) |
| Incoming Relation(s) |
| (R)-ethosuximide (CHEBI:60354) is a ethosuximide (CHEBI:4887) |
| (S)-ethosuximide (CHEBI:60355) is a ethosuximide (CHEBI:4887) |
| IUPAC Name |
|---|
| 3-ethyl-3-methylpyrrolidine-2,5-dione |
| INNs | Source |
|---|---|
| ethosuximide | ChemIDplus |
| éthosuximide | WHO MedNet |
| ethosuximidum | ChemIDplus |
| etosuximida | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-2-ethyl-2-methylsuccinimide | ChemIDplus |
| 2-ethyl-2-methylsuccinimide | ChemIDplus |
| 2-methyl-2-ethylsuccinimide | ChemIDplus |
| 3-ethyl-3-methyl-2,5-pyrrolidinedione | ChEBI |
| 3-ethyl-3-methylsuccinimide | ChemIDplus |
| 3-methyl-3-ethylpyrrolidine-2,5-dione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1087 | DrugCentral |
| 3175 | ChemSpider |
| C07505 | KEGG COMPOUND |
| D00539 | KEGG DRUG |
| DB00593 | DrugBank |
| Ethosuximide | Wikipedia |
| HMDB0014731 | HMDB |
| LSM-5195 | LINCS |
| Citations |
|---|