EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H53N3O6 |
| Net Charge | 0 |
| Average Mass | 551.769 |
| Monoisotopic Mass | 551.39344 |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NCC(C)(C)C(N)=O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C30H53N3O6/c1-19(2)22(14-21-10-11-26(38-8)27(15-21)39-13-9-12-37-7)16-24(31)25(34)17-23(20(3)4)28(35)33-18-30(5,6)29(32)36/h10-11,15,19-20,22-25,34H,9,12-14,16-18,31H2,1-8H3,(H2,32,36)(H,33,35)/t22-,23-,24-,25-/m0/s1 |
| InChIKey | UXOWGYHJODZGMF-QORCZRPOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. hypoglycemic agent A drug which lowers the blood glucose level. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aliskiren (CHEBI:601027) has role anti-arrhythmia drug (CHEBI:38070) |
| aliskiren (CHEBI:601027) has role antiatherosclerotic agent (CHEBI:145947) |
| aliskiren (CHEBI:601027) has role antihypertensive agent (CHEBI:35674) |
| aliskiren (CHEBI:601027) has role cardiovascular drug (CHEBI:35554) |
| aliskiren (CHEBI:601027) has role hypoglycemic agent (CHEBI:35526) |
| aliskiren (CHEBI:601027) has role renoprotective agent (CHEBI:231911) |
| aliskiren (CHEBI:601027) is a monocarboxylic acid amide (CHEBI:29347) |
| aliskiren (CHEBI:601027) is a monomethoxybenzene (CHEBI:25235) |
| Incoming Relation(s) |
| aliskiren fumarate (CHEBI:53777) has part aliskiren (CHEBI:601027) |
| IUPAC Name |
|---|
| (2S,4S,5S,7S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-7-[4-methoxy-3-(3-methoxypropoxy)benzyl]-8-methyl-2-(propan-2-yl)nonanamide |
| INNs | Source |
|---|---|
| aliskiren | KEGG DRUG |
| aliskirene | WHO MedNet |
| aliskireno | WHO MedNet |
| Synonyms | Source |
|---|---|
| SPP 100 | DrugBank |
| SPP-100 | ChEMBL |
| Citations |
|---|