EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H53N3O6 |
| Net Charge | 0 |
| Average Mass | 551.769 |
| Monoisotopic Mass | 551.39344 |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NCC(C)(C)C(N)=O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C30H53N3O6/c1-19(2)22(14-21-10-11-26(38-8)27(15-21)39-13-9-12-37-7)16-24(31)25(34)17-23(20(3)4)28(35)33-18-30(5,6)29(32)36/h10-11,15,19-20,22-25,34H,9,12-14,16-18,31H2,1-8H3,(H2,32,36)(H,33,35)/t22-,23-,24-,25-/m0/s1 |
| InChIKey | UXOWGYHJODZGMF-QORCZRPOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aliskiren (CHEBI:601027) has role antihypertensive agent (CHEBI:35674) |
| aliskiren (CHEBI:601027) is a monocarboxylic acid amide (CHEBI:29347) |
| aliskiren (CHEBI:601027) is a monomethoxybenzene (CHEBI:25235) |
| Incoming Relation(s) |
| aliskiren fumarate (CHEBI:53777) has part aliskiren (CHEBI:601027) |
| IUPAC Name |
|---|
| (2S,4S,5S,7S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-7-[4-methoxy-3-(3-methoxypropoxy)benzyl]-8-methyl-2-(propan-2-yl)nonanamide |
| INN | Source |
|---|---|
| aliskiren | KEGG DRUG |
| Synonym | Source |
|---|---|
| SPP 100 | DrugBank |
| Citations |
|---|