EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C30H53N3O6.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 1219.610 |
| Monoisotopic Mass | 1218.79783 |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NCC(C)(C)C(N)=O)C(C)C)C(C)C)ccc1OC.COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NCC(C)(C)C(N)=O)C(C)C)C(C)C)ccc1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C30H53N3O6.C4H4O4/c2*1-19(2)22(14-21-10-11-26(38-8)27(15-21)39-13-9-12-37-7)16-24(31)25(34)17-23(20(3)4)28(35)33-18-30(5,6)29(32)36;5-3(6)1-2-4(7)8/h2*10-11,15,19-20,22-25,34H,9,12-14,16-18,31H2,1-8H3,(H2,32,36)(H,33,35);1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*22-,23-,24-,25-;/m00./s1 |
| InChIKey | KLRSDBSKUSSCGU-KRQUFFFQSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aliskiren fumarate (CHEBI:53777) has part aliskiren (CHEBI:601027) |
| aliskiren fumarate (CHEBI:53777) has role antihypertensive agent (CHEBI:35674) |
| aliskiren fumarate (CHEBI:53777) is a fumarate salt (CHEBI:50921) |
| IUPAC Name |
|---|
| bis{(2S,4S,5S,7S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-7-[4-methoxy-3-(3-methoxypropoxy)benzyl]-8-methyl-2-(propan-2-yl)nonanamide} (2E)-but-2-enedioate |
| Synonym | Source |
|---|---|
| Aliskiren hemifumarate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8750478 | Beilstein |
| CAS:173334-58-2 | KEGG DRUG |
| CAS:173334-58-2 | ChemIDplus |