EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO4 |
| Net Charge | 0 |
| Average Mass | 295.379 |
| Monoisotopic Mass | 295.17836 |
| SMILES | COC(=O)CCc1ccc(OC[C@@H](O)CNC(C)C)cc1 |
| InChI | InChI=1S/C16H25NO4/c1-12(2)17-10-14(18)11-21-15-7-4-13(5-8-15)6-9-16(19)20-3/h4-5,7-8,12,14,17-18H,6,9-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | AQNDDEOPVVGCPG-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-esmolol (CHEBI:60075) is a methyl 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate (CHEBI:88206) |
| (S)-esmolol (CHEBI:60075) is enantiomer of (R)-esmolol (CHEBI:60074) |
| Incoming Relation(s) |
| esmolol (CHEBI:4856) has part (S)-esmolol (CHEBI:60075) |
| (R)-esmolol (CHEBI:60074) is enantiomer of (S)-esmolol (CHEBI:60075) |
| IUPAC Name |
|---|
| methyl 3-(4-{[(2S)-2-hydroxy-3-(propan-2-ylamino)propyl]oxy}phenyl)propanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21507231 | Reaxys |
| Citations |
|---|