EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21O5S |
| Net Charge | -1 |
| Average Mass | 349.428 |
| Monoisotopic Mass | 349.11152 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3ccc(OS(=O)(=O)[O-])cc3CC[C@@]21[H] |
| InChI | InChI=1S/C18H22O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22)/p-1/t14-,15-,16+,18+/m1/s1 |
| InChIKey | JKKFKPJIXZFSSB-CBZIJGRNSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estrone 3-sulfate(1−) (CHEBI:60050) has role human metabolite (CHEBI:77746) |
| estrone 3-sulfate(1−) (CHEBI:60050) is a estrane conjugate (CHEBI:167107) |
| estrone 3-sulfate(1−) (CHEBI:60050) is a steroid sulfate oxoanion (CHEBI:59696) |
| estrone 3-sulfate(1−) (CHEBI:60050) is conjugate base of estrone 3-sulfate (CHEBI:17474) |
| Incoming Relation(s) |
| estrone 3-sulfate (CHEBI:17474) is conjugate acid of estrone 3-sulfate(1−) (CHEBI:60050) |
| IUPAC Name |
|---|
| 17-oxoestra-1,3,5(10)-trien-3-yl sulfate |
| Synonym | Source |
|---|---|
| estrone 3-sulfate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| estrone 3-sulfate | UniProt |