EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O5S |
| Net Charge | 0 |
| Average Mass | 350.436 |
| Monoisotopic Mass | 350.11879 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3ccc(OS(=O)(=O)O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C18H22O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22)/t14-,15-,16+,18+/m1/s1 |
| InChIKey | JKKFKPJIXZFSSB-CBZIJGRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15356081) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (23717534) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estrone 3-sulfate (CHEBI:17474) has functional parent estrone (CHEBI:17263) |
| estrone 3-sulfate (CHEBI:17474) has parent hydride estrane (CHEBI:23966) |
| estrone 3-sulfate (CHEBI:17474) has role human metabolite (CHEBI:77746) |
| estrone 3-sulfate (CHEBI:17474) has role mouse metabolite (CHEBI:75771) |
| estrone 3-sulfate (CHEBI:17474) is a 17-oxo steroid (CHEBI:19168) |
| estrone 3-sulfate (CHEBI:17474) is a steroid sulfate (CHEBI:16158) |
| estrone 3-sulfate (CHEBI:17474) is conjugate acid of estrone 3-sulfate(1−) (CHEBI:60050) |
| Incoming Relation(s) |
| estrone 3-sulfate(1−) (CHEBI:60050) is conjugate base of estrone 3-sulfate (CHEBI:17474) |
| IUPAC Name |
|---|
| 17-oxoestra-1,3,5(10)-trien-3-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| Estrone 3-sulfate | KEGG COMPOUND |
| estrone hydrogen sulfate | ChemIDplus |
| estrone sulfate | ChemIDplus |
| estrone sulphate | ChemIDplus |
| 3-hydroxyestra-1,3,5(10)-trien-17-one hydrogen sulphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02538 | KEGG COMPOUND |
| HMDB0001425 | HMDB |
| LSM-3126 | LINCS |
| 4857 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2399598 | Reaxys |
| CAS:481-97-0 | ChemIDplus |
| Citations |
|---|