EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O3.H2O |
| Net Charge | 0 |
| Average Mass | 295.299 |
| Monoisotopic Mass | 295.12805 |
| SMILES | C=C1[C@H](CO)[C@@H](O)C[C@@H]1n1cnc2c(=O)nc(N)nc21.O |
| InChI | InChI=1S/C12H15N5O3.H2O/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20;/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20);1H2/t6-,7-,8-;/m0./s1 |
| InChIKey | YXPVEXCTPGULBZ-WQYNNSOESA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| entecavir hydrate (CHEBI:59902) has part entecavir (anhydrous) (CHEBI:473990) |
| entecavir hydrate (CHEBI:59902) has role antiviral drug (CHEBI:36044) |
| entecavir hydrate (CHEBI:59902) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| entecavir hydrate (CHEBI:59902) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| 2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,9-dihydro-6H-purin-6-one—water (1/1) |
| Synonyms | Source |
|---|---|
| 9-((1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)guanine monohydrate | ChemIDplus |
| entecavir | ChemIDplus |
| entecavir monohydrate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:209216-23-9 | KEGG DRUG |
| CAS:209216-23-9 | ChemIDplus |