EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O3 |
| Net Charge | 0 |
| Average Mass | 277.284 |
| Monoisotopic Mass | 277.11749 |
| SMILES | C=C1[C@H](CO)[C@@H](O)C[C@@H]1n1cnc2c(=O)nc(N)nc21 |
| InChI | InChI=1S/C12H15N5O3/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20)/t6-,7-,8-/m0/s1 |
| InChIKey | QDGZDCVAUDNJFG-FXQIFTODSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| entecavir (anhydrous) (CHEBI:473990) has role antiviral drug (CHEBI:36044) |
| entecavir (anhydrous) (CHEBI:473990) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| entecavir (anhydrous) (CHEBI:473990) is a 2-aminopurines (CHEBI:20702) |
| entecavir (anhydrous) (CHEBI:473990) is a oxopurine (CHEBI:25810) |
| entecavir (anhydrous) (CHEBI:473990) is a primary alcohol (CHEBI:15734) |
| entecavir (anhydrous) (CHEBI:473990) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| entecavir hydrate (CHEBI:59902) has part entecavir (anhydrous) (CHEBI:473990) |
| IUPAC Name |
|---|
| 2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1,9-dihydro-6H-purin-6-one |
| INN | Source |
|---|---|
| entecavir | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7692760 | Beilstein |
| CAS:142217-69-4 | ChemIDplus |