EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4NO4 |
| Net Charge | -1 |
| Average Mass | 118.068 |
| Monoisotopic Mass | 118.01458 |
| SMILES | O=C([O-])CC[N+](=O)[O-] |
| InChI | InChI=1S/C3H5NO4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)/p-1 |
| InChIKey | WBLZUCOIBUDNBV-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitropropanoate (CHEBI:59899) is a monocarboxylic acid anion (CHEBI:35757) |
| 3-nitropropanoate (CHEBI:59899) is conjugate base of 3-nitropropanoic acid (CHEBI:16348) |
| 3-nitropropanoate (CHEBI:59899) is tautomer of 3-aci-nitropropanoate (CHEBI:136067) |
| Incoming Relation(s) |
| 3-nitropropanoic acid (CHEBI:16348) is conjugate acid of 3-nitropropanoate (CHEBI:59899) |
| 3-aci-nitropropanoate (CHEBI:136067) is tautomer of 3-nitropropanoate (CHEBI:59899) |
| IUPAC Name |
|---|
| 3-nitropropanoate |
| Synonyms | Source |
|---|---|
| 3-nitropropanoate(1−) | ChEBI |
| 3-nitropropanoate anion | ChEBI |
| 3-nitropropionate | ChEBI |
| 3-nitropropionate(1−) | ChEBI |
| 3-nitropropionate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-nitropropanoate | UniProt |