EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO4 |
| Net Charge | 0 |
| Average Mass | 119.076 |
| Monoisotopic Mass | 119.02186 |
| SMILES | O=C(O)CC[N+](=O)[O-] |
| InChI | InChI=1S/C3H5NO4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6) |
| InChIKey | WBLZUCOIBUDNBV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. neurotoxin A poison that interferes with the functions of the nervous system. mycotoxin Poisonous substance produced by fungi. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitropropanoic acid (CHEBI:16348) has functional parent propionic acid (CHEBI:30768) |
| 3-nitropropanoic acid (CHEBI:16348) has role antimycobacterial drug (CHEBI:64912) |
| 3-nitropropanoic acid (CHEBI:16348) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| 3-nitropropanoic acid (CHEBI:16348) has role mycotoxin (CHEBI:25442) |
| 3-nitropropanoic acid (CHEBI:16348) has role neurotoxin (CHEBI:50910) |
| 3-nitropropanoic acid (CHEBI:16348) is a C-nitro compound (CHEBI:35716) |
| 3-nitropropanoic acid (CHEBI:16348) is conjugate acid of 3-nitropropanoate (CHEBI:59899) |
| 3-nitropropanoic acid (CHEBI:16348) is tautomer of 3-aci-nitropropanoic acid (CHEBI:16775) |
| Incoming Relation(s) |
| 3-nitropropanoate (CHEBI:59899) is conjugate base of 3-nitropropanoic acid (CHEBI:16348) |
| 3-aci-nitropropanoic acid (CHEBI:16775) is tautomer of 3-nitropropanoic acid (CHEBI:16348) |
| IUPAC Name |
|---|
| 3-nitropropanoic acid |
| Synonyms | Source |
|---|---|
| 3-NITROPROPANOIC ACID | PDBeChem |
| 3-nitropropionic acid | ChemIDplus |
| beta-Nitropropanoic acid | KEGG COMPOUND |
| beta-Nitropropionic acid | KEGG COMPOUND |
| Bovinocidin | ChemIDplus |
| Citations |
|---|