EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N4O15P3 |
| Net Charge | -3 |
| Average Mass | 521.141 |
| Monoisotopic Mass | 520.95285 |
| SMILES | O=c1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H15N4O15P3/c15-5-3(1-26-31(22,23)29-32(24,25)28-30(19,20)21)27-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H2,12,13,17,18)/p-3/t3-,5-,6-,9-/m1/s1 |
| InChIKey | CAEFEWVYEZABLA-UUOKFMHZSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XTP(3−) (CHEBI:59885) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| XTP(3−) (CHEBI:59885) is a xanthosine 5'-phosphate (CHEBI:53012) |
| XTP(3−) (CHEBI:59885) is conjugate acid of XTP(4−) (CHEBI:61314) |
| XTP(3−) (CHEBI:59885) is conjugate base of XTP (CHEBI:10049) |
| Incoming Relation(s) |
| XTP (CHEBI:10049) is conjugate acid of XTP(3−) (CHEBI:59885) |
| XTP(4−) (CHEBI:61314) is conjugate base of XTP(3−) (CHEBI:59885) |
| IUPAC Name |
|---|
| 5'-OO-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]xanthosine |
| Synonyms | Source |
|---|---|
| xanthosine 5' triphosphate(3−) | SUBMITTER |
| XTP trianion | ChEBI |
| xanthosine 5'-triphosphate(3−) | ChEBI |